C22H29N3O5 — CID 55340090
1-(2-methoxyphenyl)-4-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 55340090) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(2-methoxyphenyl)-4-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55340090 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccccc1N1CC(C(=O)N2CCC(C(=O)N3CCOCC3)CC2)CC1=O |
| InChI | InChI=1S/C22H29N3O5/c1-29-19-5-3-2-4-18(19)25-15-17(14-20(25)26)22(28)23-8-6-16(7-9-23)21(27)24-10-12-30-13-11-24/h2-5,16-17H,6-15H2,1H3 |
| InChIKey | MEVFQXAZWCAFPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |