C12H13NO4 — CID 2941796
1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 2941796) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 2941796 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | COc1ccccc1N1CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C12H13NO4/c1-17-10-5-3-2-4-9(10)13-7-8(12(15)16)6-11(13)14/h2-5,8H,6-7H2,1H3,(H,15,16) |
| InChIKey | BQQBMILQUDEPIK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |