C19H19NO4 — CID 7545638
benzyl (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7545638) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is benzyl (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | benzyl (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7545638 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | benzyl (3S)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1N1C[C@@H](C(=O)OCc2ccccc2)CC1=O |
| InChI | InChI=1S/C19H19NO4/c1-23-17-10-6-5-9-16(17)20-12-15(11-18(20)21)19(22)24-13-14-7-3-2-4-8-14/h2-10,15H,11-13H2,1H3/t15-/m0/s1 |
| InChIKey | RTECJUGZOVEUMM-HNNXBMFYSA-N |
| XLogP | 2.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |