C20H21NO4 — CID 7543997
(4-methylphenyl)methyl (3R)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7543997) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (4-methylphenyl)methyl (3R)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-methylphenyl)methyl (3R)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7543997 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (4-methylphenyl)methyl (3R)-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1N1C[C@H](C(=O)OCc2ccc(C)cc2)CC1=O |
| InChI | InChI=1S/C20H21NO4/c1-14-7-9-15(10-8-14)13-25-20(23)16-11-19(22)21(12-16)17-5-3-4-6-18(17)24-2/h3-10,16H,11-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | ORYBBXBHCCVFLW-MRXNPFEDSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |