C21H20N2O4 — CID 8588799
(2-cyanophenyl)methyl (3R)-1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 8588799) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (3R)-1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2-cyanophenyl)methyl (3R)-1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 8588799 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2-cyanophenyl)methyl (3R)-1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(C)cc1N1C[C@H](C(=O)OCc2ccccc2C#N)CC1=O |
| InChI | InChI=1S/C21H20N2O4/c1-14-7-8-19(26-2)18(9-14)23-12-17(10-20(23)24)21(25)27-13-16-6-4-3-5-15(16)11-22/h3-9,17H,10,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | VQLJTGWIICPFGD-QGZVFWFLSA-N |
| XLogP | 2.97 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |