C22H24N2O4 — CID 134040096
1-(2-methoxyphenyl)-4-(2-phenylmorpholine-4-carbonyl)pyrrolidin-2-one (PubChem CID 134040096) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-(2-phenylmorpholine-4-carbonyl)pyrrolidin-2-one.
| Compound Name | 1-(2-methoxyphenyl)-4-(2-phenylmorpholine-4-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134040096 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-(2-phenylmorpholine-4-carbonyl)pyrrolidin-2-one |
| SMILES | COc1ccccc1N1CC(C(=O)N2CCOC(c3ccccc3)C2)CC1=O |
| InChI | InChI=1S/C22H24N2O4/c1-27-19-10-6-5-9-18(19)24-14-17(13-21(24)25)22(26)23-11-12-28-20(15-23)16-7-3-2-4-8-16/h2-10,17,20H,11-15H2,1H3 |
| InChIKey | OVNQAZOGJHSGDZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |