C24H28N2O4 — CID 102558175
1-(2-methoxy-5-methylphenyl)-4-[2-(2-methylphenyl)morpholine-4-carbonyl]pyrrolidin-2-one (PubChem CID 102558175) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-4-[2-(2-methylphenyl)morpholine-4-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-4-[2-(2-methylphenyl)morpholine-4-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102558175 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-4-[2-(2-methylphenyl)morpholine-4-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C)cc1N1CC(C(=O)N2CCOC(c3ccccc3C)C2)CC1=O |
| InChI | InChI=1S/C24H28N2O4/c1-16-8-9-21(29-3)20(12-16)26-14-18(13-23(26)27)24(28)25-10-11-30-22(15-25)19-7-5-4-6-17(19)2/h4-9,12,18,22H,10-11,13-15H2,1-3H3 |
| InChIKey | QQWSADGQXNOTTE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |