C24H30N2O6 — CID 12887277
7,16-diphenyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione (PubChem CID 12887277) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 7,16-diphenyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione.
| Compound Name | 7,16-diphenyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione |
|---|---|
| PubChem CID | 12887277 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 7,16-diphenyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-6,17-dione |
| SMILES | O=C1COCCOCC(=O)N(c2ccccc2)CCOCCOCCN1c1ccccc1 |
| InChI | InChI=1S/C24H30N2O6/c27-23-19-31-17-18-32-20-24(28)26(22-9-5-2-6-10-22)12-14-30-16-15-29-13-11-25(23)21-7-3-1-4-8-21/h1-10H,11-20H2 |
| InChIKey | GYWYZIIOFOWOIQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |