C17H16N2O2 — CID 13379326
1,4-diphenyl-1,4-diazepane-5,7-dione (PubChem CID 13379326) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1,4-diphenyl-1,4-diazepane-5,7-dione.
| Compound Name | 1,4-diphenyl-1,4-diazepane-5,7-dione |
|---|---|
| PubChem CID | 13379326 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1,4-diphenyl-1,4-diazepane-5,7-dione |
| SMILES | O=C1CC(=O)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c20-16-13-17(21)19(15-9-5-2-6-10-15)12-11-18(16)14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | GNWCRXZMUXXKRH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|