About ethane;3-methyl-1-phenylimidazolidine-2,4-dione
ethane;3-methyl-1-phenylimidazolidine-2,4-dione (PubChem CID 145288256) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is ethane;3-methyl-1-phenylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;3-methyl-1-phenylimidazolidine-2,4-dione |
| PubChem CID | 145288256 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | ethane;3-methyl-1-phenylimidazolidine-2,4-dione |
| SMILES | CC.CN1C(=O)CN(c2ccccc2)C1=O |
| InChI | InChI=1S/C10H10N2O2.C2H6/c1-11-9(13)7-12(10(11)14)8-5-3-2-4-6-8;1-2/h2-6H,7H2,1H3;1-2H3 |
| InChIKey | GOUFADIGFCKBNW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-1-phenylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1-phenylimidazolidine-2,4-dione?
The IUPAC name of ethane;3-methyl-1-phenylimidazolidine-2,4-dione (CID 145288256) is ethane;3-methyl-1-phenylimidazolidine-2,4-dione.
What is the SMILES notation for ethane;3-methyl-1-phenylimidazolidine-2,4-dione?
The canonical SMILES for ethane;3-methyl-1-phenylimidazolidine-2,4-dione is CC.CN1C(=O)CN(c2ccccc2)C1=O.
What is the InChIKey of ethane;3-methyl-1-phenylimidazolidine-2,4-dione?
The InChIKey is GOUFADIGFCKBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.C2H6/c1-11-9(13)7-12(10(11)14)8-5-3-2-4-6-8;1-2/h2-6H,7H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1-phenylimidazolidine-2,4-dione?
ethane;3-methyl-1-phenylimidazolidine-2,4-dione has a molecular weight of 220.27 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1-phenylimidazolidine-2,4-dione is sourced from PubChem (CID 145288256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).