C16H15N3OS — CID 154246141
3-methyl-5-phenyl-2-phenylimino-1,3,5-thiadiazinan-4-one (PubChem CID 154246141) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-methyl-5-phenyl-2-phenylimino-1,3,5-thiadiazinan-4-one.
| Compound Name | 3-methyl-5-phenyl-2-phenylimino-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 154246141 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-methyl-5-phenyl-2-phenylimino-1,3,5-thiadiazinan-4-one |
| SMILES | CN1C(=O)N(c2ccccc2)CS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C16H15N3OS/c1-18-15(17-13-8-4-2-5-9-13)21-12-19(16(18)20)14-10-6-3-7-11-14/h2-11H,12H2,1H3/b17-15- |
| InChIKey | ZGOHCJXAEGQJOU-ICFOKQHNSA-N |
| XLogP | 3.94 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|