C25H29N3OS — CID 139680248
2-cyclopropylimino-3-[[4-(3,3-dimethylbut-1-enyl)phenyl]methyl]-5-phenyl-1,3,5-thiadiazinan-4-one (PubChem CID 139680248) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 2-cyclopropylimino-3-[[4-(3,3-dimethylbut-1-enyl)phenyl]methyl]-5-phenyl-1,3,5-thiadiazinan-4-one.
| Compound Name | 2-cyclopropylimino-3-[[4-(3,3-dimethylbut-1-enyl)phenyl]methyl]-5-phenyl-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 139680248 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-cyclopropylimino-3-[[4-(3,3-dimethylbut-1-enyl)phenyl]methyl]-5-phenyl-1,3,5-thiadiazinan-4-one |
| SMILES | CC(C)(C)C=Cc1ccc(CN2C(=O)N(c3ccccc3)CS/C2=N\C2CC2)cc1 |
| InChI | InChI=1S/C25H29N3OS/c1-25(2,3)16-15-19-9-11-20(12-10-19)17-27-23(26-21-13-14-21)30-18-28(24(27)29)22-7-5-4-6-8-22/h4-12,15-16,21H,13-14,17-18H2,1-3H3/b16-15?,26-23- |
| InChIKey | UDRHUMNDGYJBMK-DFHJDWQCSA-N |
| XLogP | 6.40 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|