C25H27N3OS — CID 139680251
3-cyclopropyl-2-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methylimino]-5-phenyl-1,3,5-thiadiazinan-4-one (PubChem CID 139680251) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is 3-cyclopropyl-2-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methylimino]-5-phenyl-1,3,5-thiadiazinan-4-one.
| Compound Name | 3-cyclopropyl-2-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methylimino]-5-phenyl-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 139680251 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-cyclopropyl-2-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methylimino]-5-phenyl-1,3,5-thiadiazinan-4-one |
| SMILES | CC(C)(C)C#Cc1ccc(C/N=C2\SCN(c3ccccc3)C(=O)N2C2CC2)cc1 |
| InChI | InChI=1S/C25H27N3OS/c1-25(2,3)16-15-19-9-11-20(12-10-19)17-26-23-28(22-13-14-22)24(29)27(18-30-23)21-7-5-4-6-8-21/h4-12,22H,13-14,17-18H2,1-3H3/b26-23- |
| InChIKey | PNIFECZKEKSLLY-RWEWTDSWSA-N |
| XLogP | 5.74 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|