C16H18S — CID 11287974
3-(4,4-dimethylpent-2-ynylsulfanyl)prop-1-ynylbenzene (PubChem CID 11287974) has the molecular formula C16H18S and a molecular weight of 242.39 g/mol. Its IUPAC name is 3-(4,4-dimethylpent-2-ynylsulfanyl)prop-1-ynylbenzene.
| Compound Name | 3-(4,4-dimethylpent-2-ynylsulfanyl)prop-1-ynylbenzene |
|---|---|
| PubChem CID | 11287974 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-(4,4-dimethylpent-2-ynylsulfanyl)prop-1-ynylbenzene |
| SMILES | CC(C)(C)C#CCSCC#Cc1ccccc1 |
| InChI | InChI=1S/C16H18S/c1-16(2,3)12-8-14-17-13-7-11-15-9-5-4-6-10-15/h4-6,9-10H,13-14H2,1-3H3 |
| InChIKey | AQANOYQLHJKGLA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|