C13H14O2S — CID 81222643
2-methyl-2-(3-phenylprop-2-ynylsulfanyl)propanoic acid (PubChem CID 81222643) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-methyl-2-(3-phenylprop-2-ynylsulfanyl)propanoic acid.
| Compound Name | 2-methyl-2-(3-phenylprop-2-ynylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 81222643 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-methyl-2-(3-phenylprop-2-ynylsulfanyl)propanoic acid |
| SMILES | CC(C)(SCC#Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H14O2S/c1-13(2,12(14)15)16-10-6-9-11-7-4-3-5-8-11/h3-5,7-8H,10H2,1-2H3,(H,14,15) |
| InChIKey | APGDBQMCZCHEGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|