C19H28NO+ — CID 46499959
(3,3-dimethyl-2-oxobutyl)-diethyl-(3-phenylprop-2-ynyl)azanium (PubChem CID 46499959) has the molecular formula C19H28NO+ and a molecular weight of 286.44 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl)-diethyl-(3-phenylprop-2-ynyl)azanium.
| Compound Name | (3,3-dimethyl-2-oxobutyl)-diethyl-(3-phenylprop-2-ynyl)azanium |
|---|---|
| PubChem CID | 46499959 |
| Molecular Formula | C19H28NO+ |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl)-diethyl-(3-phenylprop-2-ynyl)azanium |
| SMILES | CC[N+](CC)(CC#Cc1ccccc1)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H28NO/c1-6-20(7-2,16-18(21)19(3,4)5)15-11-14-17-12-9-8-10-13-17/h8-10,12-13H,6-7,15-16H2,1-5H3/q+1 |
| InChIKey | ZZROHSCGNUTJJE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|