C16H20S — CID 101213468
3-[(E)-4,4-dimethylpent-2-enyl]sulfanylprop-1-ynylbenzene (PubChem CID 101213468) has the molecular formula C16H20S and a molecular weight of 244.40 g/mol. Its IUPAC name is 3-[(E)-4,4-dimethylpent-2-enyl]sulfanylprop-1-ynylbenzene.
| Compound Name | 3-[(E)-4,4-dimethylpent-2-enyl]sulfanylprop-1-ynylbenzene |
|---|---|
| PubChem CID | 101213468 |
| Molecular Formula | C16H20S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-[(E)-4,4-dimethylpent-2-enyl]sulfanylprop-1-ynylbenzene |
| SMILES | CC(C)(C)/C=C/CSCC#Cc1ccccc1 |
| InChI | InChI=1S/C16H20S/c1-16(2,3)12-8-14-17-13-7-11-15-9-5-4-6-10-15/h4-6,8-10,12H,13-14H2,1-3H3/b12-8+ |
| InChIKey | HRMMMUNNEIAASD-XYOKQWHBSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|