C18H26Si — CID 101354563
[(Z)-6,6-dimethyl-1-phenylhept-4-en-1-yn-4-yl]-trimethylsilane (PubChem CID 101354563) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is [(Z)-6,6-dimethyl-1-phenylhept-4-en-1-yn-4-yl]-trimethylsilane.
| Compound Name | [(Z)-6,6-dimethyl-1-phenylhept-4-en-1-yn-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101354563 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(Z)-6,6-dimethyl-1-phenylhept-4-en-1-yn-4-yl]-trimethylsilane |
| SMILES | CC(C)(C)/C=C(/CC#Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C18H26Si/c1-18(2,3)15-17(19(4,5)6)14-10-13-16-11-8-7-9-12-16/h7-9,11-12,15H,14H2,1-6H3/b17-15- |
| InChIKey | NXRYINXEIASHCY-ICFOKQHNSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|