C25H27ClSi — CID 134900973
[(Z)-1-chloro-4,4-dimethylpent-2-en-2-yl]-triphenylsilane (PubChem CID 134900973) has the molecular formula C25H27ClSi and a molecular weight of 391.03 g/mol. Its IUPAC name is [(Z)-1-chloro-4,4-dimethylpent-2-en-2-yl]-triphenylsilane.
| Compound Name | [(Z)-1-chloro-4,4-dimethylpent-2-en-2-yl]-triphenylsilane |
|---|---|
| PubChem CID | 134900973 |
| Molecular Formula | C25H27ClSi |
| Molecular Weight | 391.03 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [(Z)-1-chloro-4,4-dimethylpent-2-en-2-yl]-triphenylsilane |
| SMILES | CC(C)(C)/C=C(/CCl)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27ClSi/c1-25(2,3)19-24(20-26)27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-19H,20H2,1-3H3/b24-19- |
| InChIKey | IRJFSWHDKJVORK-CLCOLTQESA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|