C13H18ClN — CID 134987231
N-[(E)-1-chloro-3,3-dimethylbut-1-enyl]-N-methylaniline (PubChem CID 134987231) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is N-[(E)-1-chloro-3,3-dimethylbut-1-enyl]-N-methylaniline.
| Compound Name | N-[(E)-1-chloro-3,3-dimethylbut-1-enyl]-N-methylaniline |
|---|---|
| PubChem CID | 134987231 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-[(E)-1-chloro-3,3-dimethylbut-1-enyl]-N-methylaniline |
| SMILES | CN(/C(Cl)=C\C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H18ClN/c1-13(2,3)10-12(14)15(4)11-8-6-5-7-9-11/h5-10H,1-4H3/b12-10- |
| InChIKey | VKRLARDUEDXULU-BENRWUELSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|