C15H16N2Se — CID 12787621
1,3-dimethyl-1,3-diphenylselenourea (PubChem CID 12787621) has the molecular formula C15H16N2Se and a molecular weight of 303.27 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-diphenylselenourea.
| Compound Name | 1,3-dimethyl-1,3-diphenylselenourea |
|---|---|
| PubChem CID | 12787621 |
| Molecular Formula | C15H16N2Se |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1,3-dimethyl-1,3-diphenylselenourea |
| SMILES | CN(C(=[Se])N(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2Se/c1-16(13-9-5-3-6-10-13)15(18)17(2)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | GEHHLDJPZBARCN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|