C9H12N2OS — CID 88793984
1,3-dimethyl-1-phenyl-3-sulfanylurea (PubChem CID 88793984) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is 1,3-dimethyl-1-phenyl-3-sulfanylurea.
| Compound Name | 1,3-dimethyl-1-phenyl-3-sulfanylurea |
|---|---|
| PubChem CID | 88793984 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1,3-dimethyl-1-phenyl-3-sulfanylurea |
| SMILES | CN(S)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C9H12N2OS/c1-10(9(12)11(2)13)8-6-4-3-5-7-8/h3-7,13H,1-2H3 |
| InChIKey | XAMNLEJFZORMHW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|