C14H22N2O — CID 20524964
1-methyl-1-phenyl-3,3-dipropylurea (PubChem CID 20524964) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-methyl-1-phenyl-3,3-dipropylurea.
| Compound Name | 1-methyl-1-phenyl-3,3-dipropylurea |
|---|---|
| PubChem CID | 20524964 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-methyl-1-phenyl-3,3-dipropylurea |
| SMILES | CCCN(CCC)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C14H22N2O/c1-4-11-16(12-5-2)14(17)15(3)13-9-7-6-8-10-13/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | LRPCKERCLLMBQT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |