C18H28N2 — CID 135303694
(1Z)-1-N,3-dimethyl-1-N-phenyl-1-N',1-N'-dipropylbuta-1,3-diene-1,1-diamine (PubChem CID 135303694) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is (1Z)-1-N,3-dimethyl-1-N-phenyl-1-N',1-N'-dipropylbuta-1,3-diene-1,1-diamine.
| Compound Name | (1Z)-1-N,3-dimethyl-1-N-phenyl-1-N',1-N'-dipropylbuta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 135303694 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | (1Z)-1-N,3-dimethyl-1-N-phenyl-1-N',1-N'-dipropylbuta-1,3-diene-1,1-diamine |
| SMILES | C=C(C)/C=C(/N(CCC)CCC)N(C)c1ccccc1 |
| InChI | InChI=1S/C18H28N2/c1-6-13-20(14-7-2)18(15-16(3)4)19(5)17-11-9-8-10-12-17/h8-12,15H,3,6-7,13-14H2,1-2,4-5H3/b18-15+ |
| InChIKey | VBLWQJCMLCDYQU-OBGWFSINSA-N |
| XLogP | 4.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|