C14H19N — CID 129113353
N-(3-methylbuta-1,3-dien-2-yl)-N-propylaniline (PubChem CID 129113353) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(3-methylbuta-1,3-dien-2-yl)-N-propylaniline.
| Compound Name | N-(3-methylbuta-1,3-dien-2-yl)-N-propylaniline |
|---|---|
| PubChem CID | 129113353 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-(3-methylbuta-1,3-dien-2-yl)-N-propylaniline |
| SMILES | C=C(C)C(=C)N(CCC)c1ccccc1 |
| InChI | InChI=1S/C14H19N/c1-5-11-15(13(4)12(2)3)14-9-7-6-8-10-14/h6-10H,2,4-5,11H2,1,3H3 |
| InChIKey | ZPASKNHAKNYDMO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|