C11H15N3S2 — CID 24835818
3-carbamothioyl-1-phenyl-1-propylthiourea (PubChem CID 24835818) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 3-carbamothioyl-1-phenyl-1-propylthiourea.
| Compound Name | 3-carbamothioyl-1-phenyl-1-propylthiourea |
|---|---|
| PubChem CID | 24835818 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-carbamothioyl-1-phenyl-1-propylthiourea |
| SMILES | CCCN(C(=S)NC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C11H15N3S2/c1-2-8-14(11(16)13-10(12)15)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H3,12,13,15,16) |
| InChIKey | CCJUJNINXPNMTD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|