C19H25N3S — CID 5140739
1-[2-(diethylamino)ethyl]-1,3-diphenylthiourea (PubChem CID 5140739) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1,3-diphenylthiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 5140739 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1,3-diphenylthiourea |
| SMILES | CCN(CC)CCN(C(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N3S/c1-3-21(4-2)15-16-22(18-13-9-6-10-14-18)19(23)20-17-11-7-5-8-12-17/h5-14H,3-4,15-16H2,1-2H3,(H,20,23) |
| InChIKey | BRQTXXMLBTVZMR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|