C14H15N3S2 — CID 90755015
1-(aminosulfanylmethyl)-1,3-diphenylthiourea (PubChem CID 90755015) has the molecular formula C14H15N3S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 1-(aminosulfanylmethyl)-1,3-diphenylthiourea.
| Compound Name | 1-(aminosulfanylmethyl)-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 90755015 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(aminosulfanylmethyl)-1,3-diphenylthiourea |
| SMILES | NSCN(C(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15N3S2/c15-19-11-17(13-9-5-2-6-10-13)14(18)16-12-7-3-1-4-8-12/h1-10H,11,15H2,(H,16,18) |
| InChIKey | CKNSGSHPDWLJTG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|