C15H17N3S — CID 174700414
1-(dimethylamino)-1,3-diphenylthiourea (PubChem CID 174700414) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-(dimethylamino)-1,3-diphenylthiourea.
| Compound Name | 1-(dimethylamino)-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 174700414 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(dimethylamino)-1,3-diphenylthiourea |
| SMILES | CN(C)N(C(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17N3S/c1-17(2)18(14-11-7-4-8-12-14)15(19)16-13-9-5-3-6-10-13/h3-12H,1-2H3,(H,16,19) |
| InChIKey | UOMBSXMKKATWKL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|