C16H18N4S2 — CID 88817673
1,3-dimethyl-1-[N-(phenylcarbamothioyl)anilino]thiourea (PubChem CID 88817673) has the molecular formula C16H18N4S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1,3-dimethyl-1-[N-(phenylcarbamothioyl)anilino]thiourea.
| Compound Name | 1,3-dimethyl-1-[N-(phenylcarbamothioyl)anilino]thiourea |
|---|---|
| PubChem CID | 88817673 |
| Molecular Formula | C16H18N4S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1,3-dimethyl-1-[N-(phenylcarbamothioyl)anilino]thiourea |
| SMILES | CNC(=S)N(C)N(C(=S)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N4S2/c1-17-15(21)19(2)20(14-11-7-4-8-12-14)16(22)18-13-9-5-3-6-10-13/h3-12H,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | SZKVVISNPFCRRF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|