C19H17N3S — CID 71327325
1-anilino-1,3-diphenylthiourea (PubChem CID 71327325) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-anilino-1,3-diphenylthiourea.
| Compound Name | 1-anilino-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 71327325 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-anilino-1,3-diphenylthiourea |
| SMILES | S=C(Nc1ccccc1)N(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3S/c23-19(20-16-10-4-1-5-11-16)22(18-14-8-3-9-15-18)21-17-12-6-2-7-13-17/h1-15,21H,(H,20,23) |
| InChIKey | KQJFFMBDWKQZMK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|