C21H17N3OS — CID 15176490
1-[(E)-phenacylideneamino]-1,3-diphenylthiourea (PubChem CID 15176490) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[(E)-phenacylideneamino]-1,3-diphenylthiourea.
| Compound Name | 1-[(E)-phenacylideneamino]-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 15176490 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[(E)-phenacylideneamino]-1,3-diphenylthiourea |
| SMILES | O=C(/C=N/N(C(=S)Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3OS/c25-20(17-10-4-1-5-11-17)16-22-24(19-14-8-3-9-15-19)21(26)23-18-12-6-2-7-13-18/h1-16H,(H,23,26)/b22-16+ |
| InChIKey | UQBWXMXGTHMQSC-CJLVFECKSA-N |
| XLogP | 4.76 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|