C21H16F3N3S — CID 10524960
1,3-diphenyl-1-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 10524960) has the molecular formula C21H16F3N3S and a molecular weight of 399.44 g/mol. Its IUPAC name is 1,3-diphenyl-1-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | 1,3-diphenyl-1-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 10524960 |
| Molecular Formula | C21H16F3N3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1,3-diphenyl-1-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | FC(F)(F)c1ccc(/C=N/N(C(=S)Nc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16F3N3S/c22-21(23,24)17-13-11-16(12-14-17)15-25-27(19-9-5-2-6-10-19)20(28)26-18-7-3-1-4-8-18/h1-15H,(H,26,28)/b25-15+ |
| InChIKey | MDWJDWDKSOFISH-MFKUBSTISA-N |
| XLogP | 5.94 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|