C17H14F3NO2 — CID 11954690
(E,2R)-2-hydroxy-N-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-enamide (PubChem CID 11954690) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is (E,2R)-2-hydroxy-N-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-enamide.
| Compound Name | (E,2R)-2-hydroxy-N-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 11954690 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (E,2R)-2-hydroxy-N-phenyl-4-[4-(trifluoromethyl)phenyl]but-3-enamide |
| SMILES | O=C(Nc1ccccc1)[C@H](O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)13-9-6-12(7-10-13)8-11-15(22)16(23)21-14-4-2-1-3-5-14/h1-11,15,22H,(H,21,23)/b11-8+/t15-/m1/s1 |
| InChIKey | OWRIHWPYZUEXRU-KUCQQTCKSA-N |
| XLogP | 3.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |