C24H16F6N2O2 — CID 5236437
2-benzylidene-N,N'-bis[4-(trifluoromethyl)phenyl]propanediamide (PubChem CID 5236437) has the molecular formula C24H16F6N2O2 and a molecular weight of 478.39 g/mol. Its IUPAC name is 2-benzylidene-N,N'-bis[4-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-benzylidene-N,N'-bis[4-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 5236437 |
| Molecular Formula | C24H16F6N2O2 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-benzylidene-N,N'-bis[4-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C(=Cc1ccccc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H16F6N2O2/c25-23(26,27)16-6-10-18(11-7-16)31-21(33)20(14-15-4-2-1-3-5-15)22(34)32-19-12-8-17(9-13-19)24(28,29)30/h1-14H,(H,31,33)(H,32,34) |
| InChIKey | HHAZTWDDGFFHLA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|