C18H20F3N3 — CID 164880427
N,N-diethyl-4-[(E)-[[4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]aniline (PubChem CID 164880427) has the molecular formula C18H20F3N3 and a molecular weight of 335.37 g/mol. Its IUPAC name is N,N-diethyl-4-[(E)-[[4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]aniline.
| Compound Name | N,N-diethyl-4-[(E)-[[4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]aniline |
|---|---|
| PubChem CID | 164880427 |
| Molecular Formula | C18H20F3N3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N,N-diethyl-4-[(E)-[[4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]aniline |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H20F3N3/c1-3-24(4-2)17-11-5-14(6-12-17)13-22-23-16-9-7-15(8-10-16)18(19,20)21/h5-13,23H,3-4H2,1-2H3/b22-13+ |
| InChIKey | YOGHZKYDMVBNKR-LPYMAVHISA-N |
| XLogP | 5.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|