C30H36N8 — CID 3339070
2-N,3-N-bis[[4-(diethylamino)phenyl]methylideneamino]quinoxaline-2,3-diamine (PubChem CID 3339070) has the molecular formula C30H36N8 and a molecular weight of 508.67 g/mol. Its IUPAC name is 2-N,3-N-bis[[4-(diethylamino)phenyl]methylideneamino]quinoxaline-2,3-diamine.
| Compound Name | 2-N,3-N-bis[[4-(diethylamino)phenyl]methylideneamino]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 3339070 |
| Molecular Formula | C30H36N8 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 2-N,3-N-bis[[4-(diethylamino)phenyl]methylideneamino]quinoxaline-2,3-diamine |
| SMILES | CCN(CC)c1ccc(C=NNc2nc3ccccc3nc2NN=Cc2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C30H36N8/c1-5-37(6-2)25-17-13-23(14-18-25)21-31-35-29-30(34-28-12-10-9-11-27(28)33-29)36-32-22-24-15-19-26(20-16-24)38(7-3)8-4/h9-22H,5-8H2,1-4H3,(H,33,35)(H,34,36) |
| InChIKey | RTNALLMOGUHAOL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|