C23H21N5 — CID 52946210
N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-benzylquinoxalin-2-amine (PubChem CID 52946210) has the molecular formula C23H21N5 and a molecular weight of 367.46 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-benzylquinoxalin-2-amine.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-benzylquinoxalin-2-amine |
|---|---|
| PubChem CID | 52946210 |
| Molecular Formula | C23H21N5 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-benzylquinoxalin-2-amine |
| SMILES | C/C(=N\Nc1nc2ccccc2nc1Cc1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C23H21N5/c1-16(18-11-13-19(24)14-12-18)27-28-23-22(15-17-7-3-2-4-8-17)25-20-9-5-6-10-21(20)26-23/h2-14H,15,24H2,1H3,(H,26,28)/b27-16+ |
| InChIKey | LFEWWRCELKOMCD-JVWAILMASA-N |
| XLogP | 4.64 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|