C17H20ClN3 — CID 110506082
4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-N,N-diethylaniline (PubChem CID 110506082) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 110506082 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-[(E)-[(4-chlorophenyl)hydrazinylidene]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=N/Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H20ClN3/c1-3-21(4-2)17-11-5-14(6-12-17)13-19-20-16-9-7-15(18)8-10-16/h5-13,20H,3-4H2,1-2H3/b19-13+ |
| InChIKey | YXUWJVBQFYOBAM-CPNJWEJPSA-N |
| XLogP | 4.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|