C18H20ClN3O2 — CID 6013982
2-chloro-5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 6013982) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-chloro-5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-chloro-5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 6013982 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-chloro-5-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | CCN(CC)c1ccc(/C=N\Nc2ccc(Cl)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-3-22(4-2)15-8-5-13(6-9-15)12-20-21-14-7-10-17(19)16(11-14)18(23)24/h5-12,21H,3-4H2,1-2H3,(H,23,24)/b20-12- |
| InChIKey | GYOFTPBDKZJKCY-NDENLUEZSA-N |
| XLogP | 4.33 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|