C22H21F3N4 — CID 7933215
N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 7933215) has the molecular formula C22H21F3N4 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 7933215 |
| Molecular Formula | C22H21F3N4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(Z)-[4-[benzyl(ethyl)amino]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C22H21F3N4/c1-2-29(16-18-6-4-3-5-7-18)20-11-8-17(9-12-20)14-27-28-21-13-10-19(15-26-21)22(23,24)25/h3-15H,2,16H2,1H3,(H,26,28)/b27-14- |
| InChIKey | ZGRVQMKNVFFMLI-VYYCAZPPSA-N |
| XLogP | 5.57 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|