C22H21N3O2S — CID 3760032
1-[(2,4-dimethoxyphenyl)methylideneamino]-1,3-diphenylthiourea (PubChem CID 3760032) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methylideneamino]-1,3-diphenylthiourea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methylideneamino]-1,3-diphenylthiourea |
|---|---|
| PubChem CID | 3760032 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methylideneamino]-1,3-diphenylthiourea |
| SMILES | COc1ccc(C=NN(C(=S)Nc2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-26-20-14-13-17(21(15-20)27-2)16-23-25(19-11-7-4-8-12-19)22(28)24-18-9-5-3-6-10-18/h3-16H,1-2H3,(H,24,28) |
| InChIKey | VQNUMCKMGSINJV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|