C26H24N4O2 — CID 2837790
N-[(2,4-dimethoxyphenyl)methylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine (PubChem CID 2837790) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 2837790 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-N-methyl-4,6-diphenylpyrimidin-2-amine |
| SMILES | COc1ccc(C=NN(C)c2nc(-c3ccccc3)cc(-c3ccccc3)n2)c(OC)c1 |
| InChI | InChI=1S/C26H24N4O2/c1-30(27-18-21-14-15-22(31-2)16-25(21)32-3)26-28-23(19-10-6-4-7-11-19)17-24(29-26)20-12-8-5-9-13-20/h4-18H,1-3H3 |
| InChIKey | RIFZSOXSHUJFIY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|