C25H22N4O2 — CID 137251415
4-[(Z)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 137251415) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-[(Z)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(Z)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 137251415 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[(Z)-[(4,6-diphenylpyrimidin-2-yl)-methylhydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N\N(C)c2nc(-c3ccccc3)cc(-c3ccccc3)n2)ccc1O |
| InChI | InChI=1S/C25H22N4O2/c1-29(26-17-18-13-14-23(30)24(15-18)31-2)25-27-21(19-9-5-3-6-10-19)16-22(28-25)20-11-7-4-8-12-20/h3-17,30H,1-2H3/b26-17- |
| InChIKey | HJTRFGGJZMKCNE-ONUIUJJFSA-N |
| XLogP | 5.00 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|