C23H18N4O2 — CID 139228404
4-[(E)-(5,6-diphenyl-1,2,4-triazin-3-yl)iminomethyl]-2-methoxyphenol (PubChem CID 139228404) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[(E)-(5,6-diphenyl-1,2,4-triazin-3-yl)iminomethyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-(5,6-diphenyl-1,2,4-triazin-3-yl)iminomethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 139228404 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[(E)-(5,6-diphenyl-1,2,4-triazin-3-yl)iminomethyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/c2nnc(-c3ccccc3)c(-c3ccccc3)n2)ccc1O |
| InChI | InChI=1S/C23H18N4O2/c1-29-20-14-16(12-13-19(20)28)15-24-23-25-21(17-8-4-2-5-9-17)22(26-27-23)18-10-6-3-7-11-18/h2-15,28H,1H3/b24-15+ |
| InChIKey | FUQKGUSMWBHLNO-BUVRLJJBSA-N |
| XLogP | 4.67 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|