C22H22N2O2 — CID 6047667
N-benzyl-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]aniline (PubChem CID 6047667) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-benzyl-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]aniline.
| Compound Name | N-benzyl-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 6047667 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-benzyl-N-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]aniline |
| SMILES | COc1ccc(/C=N\N(Cc2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-25-21-14-13-19(22(15-21)26-2)16-23-24(20-11-7-4-8-12-20)17-18-9-5-3-6-10-18/h3-16H,17H2,1-2H3/b23-16- |
| InChIKey | ZQKFNYHHBMBPHU-KQWNVCNZSA-N |
| XLogP | 4.74 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|