C24H25N3O4 — CID 50887236
N-benzyl-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]aniline (PubChem CID 50887236) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-benzyl-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]aniline.
| Compound Name | N-benzyl-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50887236 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-benzyl-N-[(E)-(3-methoxy-5-nitro-4-propan-2-yloxyphenyl)methylideneamino]aniline |
| SMILES | COc1cc(/C=N/N(Cc2ccccc2)c2ccccc2)cc([N+](=O)[O-])c1OC(C)C |
| InChI | InChI=1S/C24H25N3O4/c1-18(2)31-24-22(27(28)29)14-20(15-23(24)30-3)16-25-26(21-12-8-5-9-13-21)17-19-10-6-4-7-11-19/h4-16,18H,17H2,1-3H3/b25-16+ |
| InChIKey | ULXFYRSQHPPLGP-PCLIKHOPSA-N |
| XLogP | 5.43 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|