C21H19BrN2O2 — CID 3415919
4-[[benzyl(phenyl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenol (PubChem CID 3415919) has the molecular formula C21H19BrN2O2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 4-[[benzyl(phenyl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenol.
| Compound Name | 4-[[benzyl(phenyl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenol |
|---|---|
| PubChem CID | 3415919 |
| Molecular Formula | C21H19BrN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-[[benzyl(phenyl)hydrazinylidene]methyl]-2-bromo-6-methoxyphenol |
| SMILES | COc1cc(C=NN(Cc2ccccc2)c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C21H19BrN2O2/c1-26-20-13-17(12-19(22)21(20)25)14-23-24(18-10-6-3-7-11-18)15-16-8-4-2-5-9-16/h2-14,25H,15H2,1H3 |
| InChIKey | DTTIUPYFGOBOGK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|