C19H20BrN3O5 — CID 135909216
benzyl N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate (PubChem CID 135909216) has the molecular formula C19H20BrN3O5 and a molecular weight of 450.29 g/mol. Its IUPAC name is benzyl N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 135909216 |
| Molecular Formula | C19H20BrN3O5 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | benzyl N-[2-[(2Z)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate |
| SMILES | COc1cc(/C=N\NC(=O)CN(C)C(=O)OCc2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C19H20BrN3O5/c1-23(19(26)28-12-13-6-4-3-5-7-13)11-17(24)22-21-10-14-8-15(20)18(25)16(9-14)27-2/h3-10,25H,11-12H2,1-2H3,(H,22,24)/b21-10- |
| InChIKey | ZWEAZHVLKODCFF-FBHDLOMBSA-N |
| XLogP | 2.88 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|