C20H23N3O3 — CID 123497886
benzyl N-[2-[2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate (PubChem CID 123497886) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is benzyl N-[2-[2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123497886 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | benzyl N-[2-[2-[(3,4-dimethylphenyl)methylidene]hydrazinyl]-2-oxoethyl]-N-methylcarbamate |
| SMILES | Cc1ccc(C=NNC(=O)CN(C)C(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C20H23N3O3/c1-15-9-10-18(11-16(15)2)12-21-22-19(24)13-23(3)20(25)26-14-17-7-5-4-6-8-17/h4-12H,13-14H2,1-3H3,(H,22,24) |
| InChIKey | IUQOKRMZANWMMM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|